C25H25N2+ — CID 123154447
4-[2-(2,2-dimethylpropyl)-6,7-dihydrobenzo[a]quinolizin-5-ium-10-yl]benzonitrile (PubChem CID 123154447) has the molecular formula C25H25N2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylpropyl)-6,7-dihydrobenzo[a]quinolizin-5-ium-10-yl]benzonitrile.
| Compound Name | 4-[2-(2,2-dimethylpropyl)-6,7-dihydrobenzo[a]quinolizin-5-ium-10-yl]benzonitrile |
|---|---|
| PubChem CID | 123154447 |
| Molecular Formula | C25H25N2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-[2-(2,2-dimethylpropyl)-6,7-dihydrobenzo[a]quinolizin-5-ium-10-yl]benzonitrile |
| SMILES | CC(C)(C)Cc1cc[n+]2c(c1)-c1cc(-c3ccc(C#N)cc3)ccc1CC2 |
| InChI | InChI=1S/C25H25N2/c1-25(2,3)16-19-10-12-27-13-11-21-8-9-22(15-23(21)24(27)14-19)20-6-4-18(17-26)5-7-20/h4-10,12,14-15H,11,13,16H2,1-3H3/q+1 |
| InChIKey | PAHNNPIVYKOVBH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|