C24H19F2N — CID 22045606
4-(7-butyl-6,8-difluoro-9H-fluoren-2-yl)benzonitrile (PubChem CID 22045606) has the molecular formula C24H19F2N and a molecular weight of 359.42 g/mol. Its IUPAC name is 4-(7-butyl-6,8-difluoro-9H-fluoren-2-yl)benzonitrile.
| Compound Name | 4-(7-butyl-6,8-difluoro-9H-fluoren-2-yl)benzonitrile |
|---|---|
| PubChem CID | 22045606 |
| Molecular Formula | C24H19F2N |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-(7-butyl-6,8-difluoro-9H-fluoren-2-yl)benzonitrile |
| SMILES | CCCCc1c(F)cc2c(c1F)Cc1cc(-c3ccc(C#N)cc3)ccc1-2 |
| InChI | InChI=1S/C24H19F2N/c1-2-3-4-20-23(25)13-21-19-10-9-17(11-18(19)12-22(21)24(20)26)16-7-5-15(14-27)6-8-16/h5-11,13H,2-4,12H2,1H3 |
| InChIKey | RPJBZTYBALWQJO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |