C26H23F2N — CID 22045054
2-fluoro-4-(6-fluoro-7-pentyl-9,10-dihydrophenanthren-2-yl)benzonitrile (PubChem CID 22045054) has the molecular formula C26H23F2N and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-fluoro-4-(6-fluoro-7-pentyl-9,10-dihydrophenanthren-2-yl)benzonitrile.
| Compound Name | 2-fluoro-4-(6-fluoro-7-pentyl-9,10-dihydrophenanthren-2-yl)benzonitrile |
|---|---|
| PubChem CID | 22045054 |
| Molecular Formula | C26H23F2N |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-fluoro-4-(6-fluoro-7-pentyl-9,10-dihydrophenanthren-2-yl)benzonitrile |
| SMILES | CCCCCc1cc2c(cc1F)-c1ccc(-c3ccc(C#N)c(F)c3)cc1CC2 |
| InChI | InChI=1S/C26H23F2N/c1-2-3-4-5-21-13-20-8-7-19-12-17(10-11-23(19)24(20)15-26(21)28)18-6-9-22(16-29)25(27)14-18/h6,9-15H,2-5,7-8H2,1H3 |
| InChIKey | JTCAVIGNUUZDGJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|