C30H23N — CID 171461261
CID 171461261 (PubChem CID 171461261) has the molecular formula C30H23N and a molecular weight of 397.52 g/mol.
| Compound Name | CID 171461261 |
|---|---|
| PubChem CID | 171461261 |
| Molecular Formula | C30H23N |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | — |
| SMILES | [CH2-][n+]1ccccc1-c1cccc(-c2cccc(-c3cccc(-c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C30H23N/c1-31-19-6-5-18-30(31)29-17-9-16-28(22-29)27-15-8-14-26(21-27)25-13-7-12-24(20-25)23-10-3-2-4-11-23/h2-22H,1H2 |
| InChIKey | IDYXGTJZKOSKDO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|