C31H33N2+ — CID 123906206
7,7-diethyl-N,N-bis(4-methylphenyl)-6H-benzo[a]quinolizin-5-ium-10-amine (PubChem CID 123906206) has the molecular formula C31H33N2+ and a molecular weight of 433.62 g/mol. Its IUPAC name is 7,7-diethyl-N,N-bis(4-methylphenyl)-6H-benzo[a]quinolizin-5-ium-10-amine.
| Compound Name | 7,7-diethyl-N,N-bis(4-methylphenyl)-6H-benzo[a]quinolizin-5-ium-10-amine |
|---|---|
| PubChem CID | 123906206 |
| Molecular Formula | C31H33N2+ |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 7,7-diethyl-N,N-bis(4-methylphenyl)-6H-benzo[a]quinolizin-5-ium-10-amine |
| SMILES | CCC1(CC)C[n+]2ccccc2-c2cc(N(c3ccc(C)cc3)c3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C31H33N2/c1-5-31(6-2)22-32-20-8-7-9-30(32)28-21-27(18-19-29(28)31)33(25-14-10-23(3)11-15-25)26-16-12-24(4)13-17-26/h7-21H,5-6,22H2,1-4H3/q+1 |
| InChIKey | CJJWCWUIYYIZSY-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|