C32H33N2+ — CID 123316867
6-ethyl-6-pent-1-en-2-yl-N,N-diphenyl-7H-benzo[a]quinolizin-5-ium-10-amine (PubChem CID 123316867) has the molecular formula C32H33N2+ and a molecular weight of 445.63 g/mol. Its IUPAC name is 6-ethyl-6-pent-1-en-2-yl-N,N-diphenyl-7H-benzo[a]quinolizin-5-ium-10-amine.
| Compound Name | 6-ethyl-6-pent-1-en-2-yl-N,N-diphenyl-7H-benzo[a]quinolizin-5-ium-10-amine |
|---|---|
| PubChem CID | 123316867 |
| Molecular Formula | C32H33N2+ |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 6-ethyl-6-pent-1-en-2-yl-N,N-diphenyl-7H-benzo[a]quinolizin-5-ium-10-amine |
| SMILES | C=C(CCC)C1(CC)Cc2ccc(N(c3ccccc3)c3ccccc3)cc2-c2cccc[n+]21 |
| InChI | InChI=1S/C32H33N2/c1-4-14-25(3)32(5-2)24-26-20-21-29(23-30(26)31-19-12-13-22-33(31)32)34(27-15-8-6-9-16-27)28-17-10-7-11-18-28/h6-13,15-23H,3-5,14,24H2,1-2H3/q+1 |
| InChIKey | SWOSBOLWNWUMAU-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|