C63H60N2+2 — CID 123914454
4-butyl-9-[2-[2-[5-[3-(3,5-diphenylphenyl)phenyl]-2-methylphenyl]pyridin-1-ium-1-yl]ethyl]-8,9-diethyl-8H-isoquinolino[1,2-a]isoquinolin-7-ium (PubChem CID 123914454) has the molecular formula C63H60N2+2 and a molecular weight of 845.19 g/mol. Its IUPAC name is 4-butyl-9-[2-[2-[5-[3-(3,5-diphenylphenyl)phenyl]-2-methylphenyl]pyridin-1-ium-1-yl]ethyl]-8,9-diethyl-8H-isoquinolino[1,2-a]isoquinolin-7-ium.
| Compound Name | 4-butyl-9-[2-[2-[5-[3-(3,5-diphenylphenyl)phenyl]-2-methylphenyl]pyridin-1-ium-1-yl]ethyl]-8,9-diethyl-8H-isoquinolino[1,2-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 123914454 |
| Molecular Formula | C63H60N2+2 |
| Molecular Weight | 845.19 g/mol |
| Exact Mass | 844.47 |
| IUPAC Name | 4-butyl-9-[2-[2-[5-[3-(3,5-diphenylphenyl)phenyl]-2-methylphenyl]pyridin-1-ium-1-yl]ethyl]-8,9-diethyl-8H-isoquinolino[1,2-a]isoquinolin-7-ium |
| SMILES | CCCCc1cccc2c3[n+](ccc12)C(CC)C(CC)(CC[n+]1ccccc1-c1cc(-c2cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c2)ccc1C)c1ccccc1-3 |
| InChI | InChI=1S/C63H60N2/c1-5-8-21-48-26-20-30-56-55(48)35-38-65-61(6-2)63(7-3,59-31-16-15-29-57(59)62(56)65)36-39-64-37-18-17-32-60(64)58-44-51(34-33-45(58)4)49-27-19-28-50(40-49)54-42-52(46-22-11-9-12-23-46)41-53(43-54)47-24-13-10-14-25-47/h9-20,22-35,37-38,40-44,61H,5-8,21,36,39H2,1-4H3/q+2 |
| InChIKey | CUGGAGPVXAQZPV-UHFFFAOYSA-N |
| XLogP | 15.77 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.19 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|