C48H50N2O+2 — CID 90919421
7,7-diethyl-6-[2-[2-(3-methyldibenzofuran-2-yl)pyridin-1-ium-1-yl]ethyl]-2-pentyl-3-phenyl-6H-benzo[a]quinolizin-5-ium (PubChem CID 90919421) has the molecular formula C48H50N2O+2 and a molecular weight of 670.94 g/mol. Its IUPAC name is 7,7-diethyl-6-[2-[2-(3-methyldibenzofuran-2-yl)pyridin-1-ium-1-yl]ethyl]-2-pentyl-3-phenyl-6H-benzo[a]quinolizin-5-ium.
| Compound Name | 7,7-diethyl-6-[2-[2-(3-methyldibenzofuran-2-yl)pyridin-1-ium-1-yl]ethyl]-2-pentyl-3-phenyl-6H-benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 90919421 |
| Molecular Formula | C48H50N2O+2 |
| Molecular Weight | 670.94 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | 7,7-diethyl-6-[2-[2-(3-methyldibenzofuran-2-yl)pyridin-1-ium-1-yl]ethyl]-2-pentyl-3-phenyl-6H-benzo[a]quinolizin-5-ium |
| SMILES | CCCCCc1cc2[n+](cc1-c1ccccc1)C(CC[n+]1ccccc1-c1cc3c(cc1C)oc1ccccc13)C(CC)(CC)c1ccccc1-2 |
| InChI | InChI=1S/C48H50N2O/c1-5-8-10-21-36-31-44-38-23-13-15-24-42(38)48(6-2,7-3)47(50(44)33-41(36)35-19-11-9-12-20-35)27-29-49-28-18-17-25-43(49)39-32-40-37-22-14-16-26-45(37)51-46(40)30-34(39)4/h9,11-20,22-26,28,30-33,47H,5-8,10,21,27,29H2,1-4H3/q+2 |
| InChIKey | CGMMXMQWPLAVFG-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 20.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.94 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|