C52H66N2+2 — CID 123757910
2-butyl-6,7-diethyl-7-[3-[2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)-4-phenylpyridin-1-ium-1-yl]propyl]-6-methylbenzo[a]quinolizin-5-ium (PubChem CID 123757910) has the molecular formula C52H66N2+2 and a molecular weight of 719.11 g/mol. Its IUPAC name is 2-butyl-6,7-diethyl-7-[3-[2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)-4-phenylpyridin-1-ium-1-yl]propyl]-6-methylbenzo[a]quinolizin-5-ium.
| Compound Name | 2-butyl-6,7-diethyl-7-[3-[2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)-4-phenylpyridin-1-ium-1-yl]propyl]-6-methylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123757910 |
| Molecular Formula | C52H66N2+2 |
| Molecular Weight | 719.11 g/mol |
| Exact Mass | 718.52 |
| IUPAC Name | 2-butyl-6,7-diethyl-7-[3-[2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)-4-phenylpyridin-1-ium-1-yl]propyl]-6-methylbenzo[a]quinolizin-5-ium |
| SMILES | CCCCc1cc[n+]2c(c1)-c1ccccc1C(CC)(CCC[n+]1ccc(-c3ccccc3)cc1-c1cc3c(cc1C)C(C)(C)C(C)(C)C3(C)C)C2(C)CC |
| InChI | InChI=1S/C52H66N2/c1-12-15-22-38-27-32-54-47(34-38)41-25-19-20-26-43(41)52(14-3,51(54,11)13-2)29-21-30-53-31-28-40(39-23-17-16-18-24-39)35-46(53)42-36-45-44(33-37(42)4)48(5,6)50(9,10)49(45,7)8/h16-20,23-28,31-36H,12-15,21-22,29-30H2,1-11H3/q+2 |
| InChIKey | RTAYRQIJQIZEOI-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.11 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|