C46H54N2+2 — CID 174354456
(6R)-7-[2-[2-(1-ethenyl-4-phenylpyridin-1-ium-2-yl)phenyl]ethyl]-6,7-diethyl-2-heptan-2-yl-6-methylbenzo[a]quinolizin-5-ium (PubChem CID 174354456) has the molecular formula C46H54N2+2 and a molecular weight of 634.95 g/mol. Its IUPAC name is (6R)-7-[2-[2-(1-ethenyl-4-phenylpyridin-1-ium-2-yl)phenyl]ethyl]-6,7-diethyl-2-heptan-2-yl-6-methylbenzo[a]quinolizin-5-ium.
| Compound Name | (6R)-7-[2-[2-(1-ethenyl-4-phenylpyridin-1-ium-2-yl)phenyl]ethyl]-6,7-diethyl-2-heptan-2-yl-6-methylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 174354456 |
| Molecular Formula | C46H54N2+2 |
| Molecular Weight | 634.95 g/mol |
| Exact Mass | 634.43 |
| IUPAC Name | (6R)-7-[2-[2-(1-ethenyl-4-phenylpyridin-1-ium-2-yl)phenyl]ethyl]-6,7-diethyl-2-heptan-2-yl-6-methylbenzo[a]quinolizin-5-ium |
| SMILES | C=C[n+]1ccc(-c2ccccc2)cc1-c1ccccc1CCC1(CC)c2ccccc2-c2cc(C(C)CCCCC)cc[n+]2[C@]1(C)CC |
| InChI | InChI=1S/C46H54N2/c1-7-11-13-20-35(5)38-29-32-48-44(33-38)41-25-18-19-26-42(41)46(9-3,45(48,6)8-2)30-27-37-23-16-17-24-40(37)43-34-39(28-31-47(43)10-4)36-21-14-12-15-22-36/h10,12,14-19,21-26,28-29,31-35H,4,7-9,11,13,20,27,30H2,1-3,5-6H3/q+2/t35?,45-,46?/m1/s1 |
| InChIKey | PHXMEFGHVNBHPL-OJTHDBIFSA-N |
| XLogP | 11.47 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.95 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|