C44H52N2+2 — CID 123649214
9-butyl-7-[1-[2-(2,5-dimethyl-4-phenylphenyl)pyridin-1-ium-1-yl]propan-2-yl]-6,7-diethyl-6-methylbenzo[a]quinolizin-5-ium (PubChem CID 123649214) has the molecular formula C44H52N2+2 and a molecular weight of 608.91 g/mol. Its IUPAC name is 9-butyl-7-[1-[2-(2,5-dimethyl-4-phenylphenyl)pyridin-1-ium-1-yl]propan-2-yl]-6,7-diethyl-6-methylbenzo[a]quinolizin-5-ium.
| Compound Name | 9-butyl-7-[1-[2-(2,5-dimethyl-4-phenylphenyl)pyridin-1-ium-1-yl]propan-2-yl]-6,7-diethyl-6-methylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123649214 |
| Molecular Formula | C44H52N2+2 |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 608.41 |
| IUPAC Name | 9-butyl-7-[1-[2-(2,5-dimethyl-4-phenylphenyl)pyridin-1-ium-1-yl]propan-2-yl]-6,7-diethyl-6-methylbenzo[a]quinolizin-5-ium |
| SMILES | CCCCc1ccc2c(c1)C(CC)(C(C)C[n+]1ccccc1-c1cc(C)c(-c3ccccc3)cc1C)C(C)(CC)[n+]1ccccc1-2 |
| InChI | InChI=1S/C44H52N2/c1-8-11-19-35-24-25-37-40(30-35)44(10-3,43(7,9-2)46-27-18-16-23-42(37)46)34(6)31-45-26-17-15-22-41(45)39-29-32(4)38(28-33(39)5)36-20-13-12-14-21-36/h12-18,20-30,34H,8-11,19,31H2,1-7H3/q+2 |
| InChIKey | TXCHMLTXWGQKNE-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|