C36H43N2+ — CID 123902878
15-(2,6-dimethylphenyl)-6,7-diethyl-6,7-dimethyl-15-aza-5-azoniahexacyclo[17.3.2.02,18.04,16.05,14.08,13]tetracosa-2,4(16),5(14),8,10,12,17-heptaene (PubChem CID 123902878) has the molecular formula C36H43N2+ and a molecular weight of 503.75 g/mol. Its IUPAC name is 15-(2,6-dimethylphenyl)-6,7-diethyl-6,7-dimethyl-15-aza-5-azoniahexacyclo[17.3.2.02,18.04,16.05,14.08,13]tetracosa-2,4(16),5(14),8,10,12,17-heptaene.
| Compound Name | 15-(2,6-dimethylphenyl)-6,7-diethyl-6,7-dimethyl-15-aza-5-azoniahexacyclo[17.3.2.02,18.04,16.05,14.08,13]tetracosa-2,4(16),5(14),8,10,12,17-heptaene |
|---|---|
| PubChem CID | 123902878 |
| Molecular Formula | C36H43N2+ |
| Molecular Weight | 503.75 g/mol |
| Exact Mass | 503.34 |
| IUPAC Name | 15-(2,6-dimethylphenyl)-6,7-diethyl-6,7-dimethyl-15-aza-5-azoniahexacyclo[17.3.2.02,18.04,16.05,14.08,13]tetracosa-2,4(16),5(14),8,10,12,17-heptaene |
| SMILES | CCC1(C)c2ccccc2-c2n(-c3c(C)cccc3C)c3cc4c(cc3[n+]2C1(C)CC)C1CCCC4CC1 |
| InChI | InChI=1S/C36H43N2/c1-7-35(5)30-18-10-9-17-27(30)34-37(33-23(3)13-11-14-24(33)4)31-21-28-25-15-12-16-26(20-19-25)29(28)22-32(31)38(34)36(35,6)8-2/h9-11,13-14,17-18,21-22,25-26H,7-8,12,15-16,19-20H2,1-6H3/q+1 |
| InChIKey | HUUUAJYCZDHVLB-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.75 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|