C45H60N+ — CID 123151655
2-(2-cyclohexyl-6-hexan-3-ylphenyl)-1,5,6-triethyl-5,6-dimethyl-10-(2-methylphenyl)-1H-pyrrolo[2,1-a]isoquinolin-4-ium (PubChem CID 123151655) has the molecular formula C45H60N+ and a molecular weight of 614.98 g/mol. Its IUPAC name is 2-(2-cyclohexyl-6-hexan-3-ylphenyl)-1,5,6-triethyl-5,6-dimethyl-10-(2-methylphenyl)-1H-pyrrolo[2,1-a]isoquinolin-4-ium.
| Compound Name | 2-(2-cyclohexyl-6-hexan-3-ylphenyl)-1,5,6-triethyl-5,6-dimethyl-10-(2-methylphenyl)-1H-pyrrolo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123151655 |
| Molecular Formula | C45H60N+ |
| Molecular Weight | 614.98 g/mol |
| Exact Mass | 614.47 |
| IUPAC Name | 2-(2-cyclohexyl-6-hexan-3-ylphenyl)-1,5,6-triethyl-5,6-dimethyl-10-(2-methylphenyl)-1H-pyrrolo[2,1-a]isoquinolin-4-ium |
| SMILES | CCCC(CC)c1cccc(C2CCCCC2)c1C1=C[N+]2=C(c3c(-c4ccccc4C)cccc3C(C)(CC)C2(C)CC)C1CC |
| InChI | InChI=1S/C45H60N/c1-9-21-32(10-2)36-26-19-27-37(33-23-15-14-16-24-33)41(36)39-30-46-43(34(39)11-3)42-38(35-25-18-17-22-31(35)6)28-20-29-40(42)44(7,12-4)45(46,8)13-5/h17-20,22,25-30,32-34H,9-16,21,23-24H2,1-8H3/q+1 |
| InChIKey | HTRNEHDFFAXBQU-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.98 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|