C42H53N2+ — CID 123938429
9-(2,6-dicyclohexylphenyl)-12,13-diethyl-6,12,13-trimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,9,11(19),14,16-heptaene (PubChem CID 123938429) has the molecular formula C42H53N2+ and a molecular weight of 585.90 g/mol. Its IUPAC name is 9-(2,6-dicyclohexylphenyl)-12,13-diethyl-6,12,13-trimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,9,11(19),14,16-heptaene.
| Compound Name | 9-(2,6-dicyclohexylphenyl)-12,13-diethyl-6,12,13-trimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,9,11(19),14,16-heptaene |
|---|---|
| PubChem CID | 123938429 |
| Molecular Formula | C42H53N2+ |
| Molecular Weight | 585.90 g/mol |
| Exact Mass | 585.42 |
| IUPAC Name | 9-(2,6-dicyclohexylphenyl)-12,13-diethyl-6,12,13-trimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,9,11(19),14,16-heptaene |
| SMILES | CCC1(C)c2cccc3c4c(n5c(-c6c(C7CCCCC7)cccc6C6CCCCC6)c[n+](c5c23)C1(C)CC)C(C)CC=C4 |
| InChI | InChI=1S/C42H53N2/c1-6-41(4)35-26-16-24-33-34-25-14-17-28(3)39(34)44-36(27-43(40(44)38(33)35)42(41,5)7-2)37-31(29-18-10-8-11-19-29)22-15-23-32(37)30-20-12-9-13-21-30/h14-16,22-30H,6-13,17-21H2,1-5H3/q+1 |
| InChIKey | ONCLVLPRHBJFFQ-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.90 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|