C26H32NO+ — CID 123490493
9,10-diethyl-5,5,9,10,16-pentamethyl-3-oxa-8-azoniapentacyclo[9.6.2.02,6.08,18.015,19]nonadeca-1,6,8(18),11,13,15(19),16-heptaene (PubChem CID 123490493) has the molecular formula C26H32NO+ and a molecular weight of 374.55 g/mol. Its IUPAC name is 9,10-diethyl-5,5,9,10,16-pentamethyl-3-oxa-8-azoniapentacyclo[9.6.2.02,6.08,18.015,19]nonadeca-1,6,8(18),11,13,15(19),16-heptaene.
| Compound Name | 9,10-diethyl-5,5,9,10,16-pentamethyl-3-oxa-8-azoniapentacyclo[9.6.2.02,6.08,18.015,19]nonadeca-1,6,8(18),11,13,15(19),16-heptaene |
|---|---|
| PubChem CID | 123490493 |
| Molecular Formula | C26H32NO+ |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 9,10-diethyl-5,5,9,10,16-pentamethyl-3-oxa-8-azoniapentacyclo[9.6.2.02,6.08,18.015,19]nonadeca-1,6,8(18),11,13,15(19),16-heptaene |
| SMILES | CCC1(C)c2cccc3c(C)cc4c5c(c[n+](c4c23)C1(C)CC)C(C)(C)CO5 |
| InChI | InChI=1S/C26H32NO/c1-8-25(6)19-12-10-11-17-16(3)13-18-22(21(17)19)27(26(25,7)9-2)14-20-23(18)28-15-24(20,4)5/h10-14H,8-9,15H2,1-7H3/q+1 |
| InChIKey | JJKVISUUJLLBAX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|