C31H36N+ — CID 123287436
6,7-diethyl-6,7,14,16,18-pentamethyl-5-azoniaoctacyclo[10.9.2.05,22.08,23.013,21.014,17.016,18.017,20]tricosa-1(22),2,4,8,10,12(23),13(21)-heptaene (PubChem CID 123287436) has the molecular formula C31H36N+ and a molecular weight of 422.64 g/mol. Its IUPAC name is 6,7-diethyl-6,7,14,16,18-pentamethyl-5-azoniaoctacyclo[10.9.2.05,22.08,23.013,21.014,17.016,18.017,20]tricosa-1(22),2,4,8,10,12(23),13(21)-heptaene.
| Compound Name | 6,7-diethyl-6,7,14,16,18-pentamethyl-5-azoniaoctacyclo[10.9.2.05,22.08,23.013,21.014,17.016,18.017,20]tricosa-1(22),2,4,8,10,12(23),13(21)-heptaene |
|---|---|
| PubChem CID | 123287436 |
| Molecular Formula | C31H36N+ |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 6,7-diethyl-6,7,14,16,18-pentamethyl-5-azoniaoctacyclo[10.9.2.05,22.08,23.013,21.014,17.016,18.017,20]tricosa-1(22),2,4,8,10,12(23),13(21)-heptaene |
| SMILES | CCC1(C)c2cccc3c4c(c5ccc[n+](c5c23)C1(C)CC)C1CC2(C)C3(C)CC4(C)C123 |
| InChI | InChI=1S/C31H36N/c1-8-26(3)20-14-10-12-18-23(20)25-19(13-11-15-32(25)30(26,7)9-2)22-21-16-28(5)29(6)17-27(4,24(18)22)31(21,28)29/h10-15,21H,8-9,16-17H2,1-7H3/q+1 |
| InChIKey | KKKTTYRKPKAQEA-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|