C30H35NO — CID 123998407
6,7-diethyl-6,7,15,16,18-pentamethyl-1-azaheptacyclo[10.7.2.114,16.05,20.08,21.013,19.015,18]docosa-2,5(20),8,10,12(21),13(19)-hexaen-4-one (PubChem CID 123998407) has the molecular formula C30H35NO and a molecular weight of 425.62 g/mol. Its IUPAC name is 6,7-diethyl-6,7,15,16,18-pentamethyl-1-azaheptacyclo[10.7.2.114,16.05,20.08,21.013,19.015,18]docosa-2,5(20),8,10,12(21),13(19)-hexaen-4-one.
| Compound Name | 6,7-diethyl-6,7,15,16,18-pentamethyl-1-azaheptacyclo[10.7.2.114,16.05,20.08,21.013,19.015,18]docosa-2,5(20),8,10,12(21),13(19)-hexaen-4-one |
|---|---|
| PubChem CID | 123998407 |
| Molecular Formula | C30H35NO |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 6,7-diethyl-6,7,15,16,18-pentamethyl-1-azaheptacyclo[10.7.2.114,16.05,20.08,21.013,19.015,18]docosa-2,5(20),8,10,12(21),13(19)-hexaen-4-one |
| SMILES | CCC1(C)c2cccc3c4c(n5ccc(=O)c(c5c23)C1(C)CC)C1(C)CC2(C)CC4C21C |
| InChI | InChI=1S/C30H35NO/c1-8-27(4)18-12-10-11-17-21(18)24-23(28(27,5)9-2)20(32)13-14-31(24)25-22(17)19-15-26(3)16-29(25,6)30(19,26)7/h10-14,19H,8-9,15-16H2,1-7H3 |
| InChIKey | QLMWUQWTEPYKBD-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|