C19H19N3O — CID 90254122
1,19,19-trimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,8.09,14]nonadeca-2(15),4,7,9(14),10,12-hexaen-6-one (PubChem CID 90254122) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 1,19,19-trimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,8.09,14]nonadeca-2(15),4,7,9(14),10,12-hexaen-6-one.
| Compound Name | 1,19,19-trimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,8.09,14]nonadeca-2(15),4,7,9(14),10,12-hexaen-6-one |
|---|---|
| PubChem CID | 90254122 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1,19,19-trimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,8.09,14]nonadeca-2(15),4,7,9(14),10,12-hexaen-6-one |
| SMILES | CC12CCC(c3c1n1ccc(=O)nc1c1cccnc31)C2(C)C |
| InChI | InChI=1S/C19H19N3O/c1-18(2)12-6-8-19(18,3)16-14(12)15-11(5-4-9-20-15)17-21-13(23)7-10-22(16)17/h4-5,7,9-10,12H,6,8H2,1-3H3 |
| InChIKey | FGQXCHVGGGYIRX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|