C28H38O2 — CID 159226185
benzene;bis(1,7,7-trimethyl-3-methylidenebicyclo[2.2.1]heptan-2-one) (PubChem CID 159226185) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is benzene;bis(1,7,7-trimethyl-3-methylidenebicyclo[2.2.1]heptan-2-one).
| Compound Name | benzene;bis(1,7,7-trimethyl-3-methylidenebicyclo[2.2.1]heptan-2-one) |
|---|---|
| PubChem CID | 159226185 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | benzene;bis(1,7,7-trimethyl-3-methylidenebicyclo[2.2.1]heptan-2-one) |
| SMILES | C=C1C(=O)C2(C)CCC1C2(C)C.C=C1C(=O)C2(C)CCC1C2(C)C.c1ccccc1 |
| InChI | InChI=1S/2C11H16O.C6H6/c2*1-7-8-5-6-11(4,9(7)12)10(8,2)3;1-2-4-6-5-3-1/h2*8H,1,5-6H2,2-4H3;1-6H |
| InChIKey | KSHVQIQKBNZTTR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|