C16H19NO — CID 54284598
1,7,7-trimethyl-3-(pyridin-2-ylmethylidene)bicyclo[2.2.1]heptan-2-one (PubChem CID 54284598) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 1,7,7-trimethyl-3-(pyridin-2-ylmethylidene)bicyclo[2.2.1]heptan-2-one.
| Compound Name | 1,7,7-trimethyl-3-(pyridin-2-ylmethylidene)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 54284598 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1,7,7-trimethyl-3-(pyridin-2-ylmethylidene)bicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(C(=Cc3ccccn3)C1=O)C2(C)C |
| InChI | InChI=1S/C16H19NO/c1-15(2)13-7-8-16(15,3)14(18)12(13)10-11-6-4-5-9-17-11/h4-6,9-10,13H,7-8H2,1-3H3 |
| InChIKey | RTFDFZZMCNDRTP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|