C20H20N2 — CID 10565312
(1R,16S)-1,19,19-trimethyl-3,6-diazapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2(15),3,5(10),6,8,11,13-heptaene (PubChem CID 10565312) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1R,16S)-1,19,19-trimethyl-3,6-diazapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2(15),3,5(10),6,8,11,13-heptaene.
| Compound Name | (1R,16S)-1,19,19-trimethyl-3,6-diazapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2(15),3,5(10),6,8,11,13-heptaene |
|---|---|
| PubChem CID | 10565312 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (1R,16S)-1,19,19-trimethyl-3,6-diazapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2(15),3,5(10),6,8,11,13-heptaene |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)c1nc3c(ccc4cccnc43)cc12 |
| InChI | InChI=1S/C20H20N2/c1-19(2)15-8-9-20(19,3)18-14(15)11-13-7-6-12-5-4-10-21-16(12)17(13)22-18/h4-7,10-11,15H,8-9H2,1-3H3/t15-,20+/m1/s1 |
| InChIKey | KOPDKNBRPKXUCY-QRWLVFNGSA-N |
| XLogP | 4.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|