C22H22N2 — CID 102174000
2-[(1S,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]-1,10-phenanthroline (PubChem CID 102174000) has the molecular formula C22H22N2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[(1S,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]-1,10-phenanthroline.
| Compound Name | 2-[(1S,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 102174000 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-[(1S,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]-1,10-phenanthroline |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C=C2c1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C22H22N2/c1-21(2)17-10-11-22(21,3)13-16(17)18-9-8-15-7-6-14-5-4-12-23-19(14)20(15)24-18/h4-9,12-13,17H,10-11H2,1-3H3/t17-,22+/m1/s1 |
| InChIKey | DDMATFPMTQXJKT-VGSWGCGISA-N |
| XLogP | 5.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|