C33H37N2+ — CID 123726906
9-(2,6-dimethylphenyl)-12,12,13-triethyl-4,13-dimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,5,9,11(19),14,16-octaene (PubChem CID 123726906) has the molecular formula C33H37N2+ and a molecular weight of 461.67 g/mol. Its IUPAC name is 9-(2,6-dimethylphenyl)-12,12,13-triethyl-4,13-dimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,5,9,11(19),14,16-octaene.
| Compound Name | 9-(2,6-dimethylphenyl)-12,12,13-triethyl-4,13-dimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,5,9,11(19),14,16-octaene |
|---|---|
| PubChem CID | 123726906 |
| Molecular Formula | C33H37N2+ |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 9-(2,6-dimethylphenyl)-12,12,13-triethyl-4,13-dimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2(7),3,5,9,11(19),14,16-octaene |
| SMILES | CCC1(C)c2cccc3c4cc(C)ccc4n4c(-c5c(C)cccc5C)c[n+](c4c23)C1(CC)CC |
| InChI | InChI=1S/C33H37N2/c1-8-32(7)26-16-12-15-24-25-19-21(4)17-18-27(25)35-28(29-22(5)13-11-14-23(29)6)20-34(31(35)30(24)26)33(32,9-2)10-3/h11-20H,8-10H2,1-7H3/q+1 |
| InChIKey | JQHKWYRTGHPOIO-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|