C37H45N2+ — CID 123808521
9-[2,6-bis(2-methylpropyl)phenyl]-12,13-diethyl-12,13-dimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,9,11(19),14,16-octaene (PubChem CID 123808521) has the molecular formula C37H45N2+ and a molecular weight of 517.78 g/mol. Its IUPAC name is 9-[2,6-bis(2-methylpropyl)phenyl]-12,13-diethyl-12,13-dimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,9,11(19),14,16-octaene.
| Compound Name | 9-[2,6-bis(2-methylpropyl)phenyl]-12,13-diethyl-12,13-dimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,9,11(19),14,16-octaene |
|---|---|
| PubChem CID | 123808521 |
| Molecular Formula | C37H45N2+ |
| Molecular Weight | 517.78 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | 9-[2,6-bis(2-methylpropyl)phenyl]-12,13-diethyl-12,13-dimethyl-8-aza-11-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,9,11(19),14,16-octaene |
| SMILES | CCC1(C)c2cccc3c4ccccc4n4c(-c5c(CC(C)C)cccc5CC(C)C)c[n+](c4c23)C1(C)CC |
| InChI | InChI=1S/C37H45N2/c1-9-36(7)30-19-14-18-29-28-17-11-12-20-31(28)39-32(23-38(35(39)34(29)30)37(36,8)10-2)33-26(21-24(3)4)15-13-16-27(33)22-25(5)6/h11-20,23-25H,9-10,21-22H2,1-8H3/q+1 |
| InChIKey | DMURRNJCRFWNIC-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.78 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|