C34H42N3+ — CID 140932615
3-[2,6-bis(2-methylpropyl)phenyl]-9-tert-butyl-5,8-dimethyl-2,11-diaza-5-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11,13,15-octaene (PubChem CID 140932615) has the molecular formula C34H42N3+ and a molecular weight of 492.73 g/mol. Its IUPAC name is 3-[2,6-bis(2-methylpropyl)phenyl]-9-tert-butyl-5,8-dimethyl-2,11-diaza-5-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11,13,15-octaene.
| Compound Name | 3-[2,6-bis(2-methylpropyl)phenyl]-9-tert-butyl-5,8-dimethyl-2,11-diaza-5-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 140932615 |
| Molecular Formula | C34H42N3+ |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | 3-[2,6-bis(2-methylpropyl)phenyl]-9-tert-butyl-5,8-dimethyl-2,11-diaza-5-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11,13,15-octaene |
| SMILES | Cc1c(C(C)(C)C)cnc2c3ccccc3n3c(-c4c(CC(C)C)cccc4CC(C)C)c[n+](C)c3c12 |
| InChI | InChI=1S/C34H42N3/c1-21(2)17-24-13-12-14-25(18-22(3)4)31(24)29-20-36(9)33-30-23(5)27(34(6,7)8)19-35-32(30)26-15-10-11-16-28(26)37(29)33/h10-16,19-22H,17-18H2,1-9H3/q+1 |
| InChIKey | QWNCGRHLSSVLDG-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|