C29H30N2 — CID 157249771
3-[2-(2-deuterio-2-methylpropyl)-6-(2,3,3,3-tetradeuterio-2-methylpropyl)phenyl]imidazo[1,2-f]phenanthridine (PubChem CID 157249771) has the molecular formula C29H30N2 and a molecular weight of 411.60 g/mol. Its IUPAC name is 3-[2-(2-deuterio-2-methylpropyl)-6-(2,3,3,3-tetradeuterio-2-methylpropyl)phenyl]imidazo[1,2-f]phenanthridine.
| Compound Name | 3-[2-(2-deuterio-2-methylpropyl)-6-(2,3,3,3-tetradeuterio-2-methylpropyl)phenyl]imidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 157249771 |
| Molecular Formula | C29H30N2 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 3-[2-(2-deuterio-2-methylpropyl)-6-(2,3,3,3-tetradeuterio-2-methylpropyl)phenyl]imidazo[1,2-f]phenanthridine |
| SMILES | [2H]C(C)(C)Cc1cccc(CC([2H])(C)C([2H])([2H])[2H])c1-c1cnc2c3ccccc3c3ccccc3n12 |
| InChI | InChI=1S/C29H30N2/c1-19(2)16-21-10-9-11-22(17-20(3)4)28(21)27-18-30-29-25-14-6-5-12-23(25)24-13-7-8-15-26(24)31(27)29/h5-15,18-20H,16-17H2,1-4H3/i1D3,19D,20D |
| InChIKey | BWZGUQVLYOYNKB-QVYKYWJOSA-N |
| XLogP | 7.70 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|