C27H26N2 — CID 58163242
7-methyl-3-(2,3,4,5,6-pentamethylphenyl)imidazo[1,2-f]phenanthridine (PubChem CID 58163242) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 7-methyl-3-(2,3,4,5,6-pentamethylphenyl)imidazo[1,2-f]phenanthridine.
| Compound Name | 7-methyl-3-(2,3,4,5,6-pentamethylphenyl)imidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 58163242 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 7-methyl-3-(2,3,4,5,6-pentamethylphenyl)imidazo[1,2-f]phenanthridine |
| SMILES | Cc1ccc2c(c1)c1ccccc1c1ncc(-c3c(C)c(C)c(C)c(C)c3C)n21 |
| InChI | InChI=1S/C27H26N2/c1-15-11-12-24-23(13-15)21-9-7-8-10-22(21)27-28-14-25(29(24)27)26-19(5)17(3)16(2)18(4)20(26)6/h7-14H,1-6H3 |
| InChIKey | PHXFIOFQQXBGRF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|