C25H21IrN2- — CID 58943914
iridium;7-methyl-3-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 58943914) has the molecular formula C25H21IrN2- and a molecular weight of 541.67 g/mol. Its IUPAC name is iridium;7-methyl-3-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | iridium;7-methyl-3-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 58943914 |
| Molecular Formula | C25H21IrN2- |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | iridium;7-methyl-3-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | Cc1cc(C)c(-c2cnc3c4[c-]cccc4c4cc(C)ccc4n23)c(C)c1.[Ir] |
| InChI | InChI=1S/C25H21N2.Ir/c1-15-9-10-22-21(13-15)19-7-5-6-8-20(19)25-26-14-23(27(22)25)24-17(3)11-16(2)12-18(24)4;/h5-7,9-14H,1-4H3;/q-1; |
| InChIKey | KLWWEYUKNJZJET-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|