C16H11BrN2Zn — CID 58163088
bromozinc(1+);7-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 58163088) has the molecular formula C16H11BrN2Zn and a molecular weight of 376.57 g/mol. Its IUPAC name is bromozinc(1+);7-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | bromozinc(1+);7-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 58163088 |
| Molecular Formula | C16H11BrN2Zn |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | bromozinc(1+);7-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | Cc1ccc2c(c1)c1ccc[c-]c1c1nccn21.[Zn+]Br |
| InChI | InChI=1S/C16H11N2.BrH.Zn/c1-11-6-7-15-14(10-11)12-4-2-3-5-13(12)16-17-8-9-18(15)16;;/h2-4,6-10H,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | FWGRGLLAYFWEAO-UHFFFAOYSA-M |
| XLogP | 4.59 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|