C17H13IN2S2Zn — CID 58163198
5,7-bis(methylsulfanyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iodozinc(1+) (PubChem CID 58163198) has the molecular formula C17H13IN2S2Zn and a molecular weight of 501.73 g/mol. Its IUPAC name is 5,7-bis(methylsulfanyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iodozinc(1+).
| Compound Name | 5,7-bis(methylsulfanyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iodozinc(1+) |
|---|---|
| PubChem CID | 58163198 |
| Molecular Formula | C17H13IN2S2Zn |
| Molecular Weight | 501.73 g/mol |
| Exact Mass | 499.89 |
| IUPAC Name | 5,7-bis(methylsulfanyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iodozinc(1+) |
| SMILES | CSc1cc(SC)c2c(c1)c1ccc[c-]c1c1nccn12.[Zn+]I |
| InChI | InChI=1S/C17H13N2S2.HI.Zn/c1-20-11-9-14-12-5-3-4-6-13(12)17-18-7-8-19(17)16(14)15(10-11)21-2;;/h3-5,7-10H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | PVQCMHBMULSMJH-UHFFFAOYSA-M |
| XLogP | 5.77 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|