C21H12IrN2Pr-2 — CID 59858700
iridium;7-phenyl-12H-imidazo[1,2-f]phenanthridin-12-ide;praseodymium (PubChem CID 59858700) has the molecular formula C21H12IrN2Pr-2 and a molecular weight of 625.47 g/mol. Its IUPAC name is iridium;7-phenyl-12H-imidazo[1,2-f]phenanthridin-12-ide;praseodymium.
| Compound Name | iridium;7-phenyl-12H-imidazo[1,2-f]phenanthridin-12-ide;praseodymium |
|---|---|
| PubChem CID | 59858700 |
| Molecular Formula | C21H12IrN2Pr-2 |
| Molecular Weight | 625.47 g/mol |
| Exact Mass | 625.97 |
| IUPAC Name | iridium;7-phenyl-12H-imidazo[1,2-f]phenanthridin-12-ide;praseodymium |
| SMILES | [Ir].[Pr].[c-]1ccc(-c2ccc3c(c2)c2ccc[c-]c2c2nccn32)cc1 |
| InChI | InChI=1S/C21H12N2.Ir.Pr/c1-2-6-15(7-3-1)16-10-11-20-19(14-16)17-8-4-5-9-18(17)21-22-12-13-23(20)21;;/h2-8,10-14H;;/q-2;; |
| InChIKey | POYQFYUFKUVZSK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|