C24H17BIrN4-2 — CID 59583141
12H-imidazo[1,2-f]phenanthridin-12-ide;iridium;2-pyridin-2-yl-1-azanida-2-boracyclohexa-3,5-diene (PubChem CID 59583141) has the molecular formula C24H17BIrN4-2 and a molecular weight of 564.46 g/mol. Its IUPAC name is 12H-imidazo[1,2-f]phenanthridin-12-ide;iridium;2-pyridin-2-yl-1-azanida-2-boracyclohexa-3,5-diene.
| Compound Name | 12H-imidazo[1,2-f]phenanthridin-12-ide;iridium;2-pyridin-2-yl-1-azanida-2-boracyclohexa-3,5-diene |
|---|---|
| PubChem CID | 59583141 |
| Molecular Formula | C24H17BIrN4-2 |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 12H-imidazo[1,2-f]phenanthridin-12-ide;iridium;2-pyridin-2-yl-1-azanida-2-boracyclohexa-3,5-diene |
| SMILES | C1=C[N-]B(c2ccccn2)C=C1.[Ir].[c-]1cccc2c1c1nccn1c1ccccc21 |
| InChI | InChI=1S/C15H9N2.C9H8BN2.Ir/c1-2-7-13-11(5-1)12-6-3-4-8-14(12)17-10-9-16-15(13)17;1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-6,8-10H;1-8H;/q2*-1; |
| InChIKey | FQLPTSROKIHQGF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 44.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|