C22H12IrN3- — CID 58943943
iridium;9-(3-isocyanophenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 58943943) has the molecular formula C22H12IrN3- and a molecular weight of 510.58 g/mol. Its IUPAC name is iridium;9-(3-isocyanophenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | iridium;9-(3-isocyanophenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 58943943 |
| Molecular Formula | C22H12IrN3- |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | iridium;9-(3-isocyanophenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | [C-]#[N+]c1cccc(-c2cc[c-]c3c2c2ccccc2n2ccnc32)c1.[Ir] |
| InChI | InChI=1S/C22H12N3.Ir/c1-23-16-7-4-6-15(14-16)17-9-5-10-19-21(17)18-8-2-3-11-20(18)25-13-12-24-22(19)25;/h2-9,11-14H;/q-1; |
| InChIKey | LJKPXQBQQFSIRF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 21.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|