C17H14N2 — CID 58943988
7,10-dimethylimidazo[1,2-f]phenanthridine (PubChem CID 58943988) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 7,10-dimethylimidazo[1,2-f]phenanthridine.
| Compound Name | 7,10-dimethylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 58943988 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 7,10-dimethylimidazo[1,2-f]phenanthridine |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n1ccnc21 |
| InChI | InChI=1S/C17H14N2/c1-11-3-5-13-14(9-11)15-10-12(2)4-6-16(15)19-8-7-18-17(13)19/h3-10H,1-2H3 |
| InChIKey | HCMDAUAJSODEBW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|