C19H17BrN2 — CID 154610318
11-bromo-7-tert-butylimidazo[1,2-f]phenanthridine (PubChem CID 154610318) has the molecular formula C19H17BrN2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 11-bromo-7-tert-butylimidazo[1,2-f]phenanthridine.
| Compound Name | 11-bromo-7-tert-butylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 154610318 |
| Molecular Formula | C19H17BrN2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 11-bromo-7-tert-butylimidazo[1,2-f]phenanthridine |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccc(Br)cc1c1nccn21 |
| InChI | InChI=1S/C19H17BrN2/c1-19(2,3)12-4-7-17-15(10-12)14-6-5-13(20)11-16(14)18-21-8-9-22(17)18/h4-11H,1-3H3 |
| InChIKey | RKTOUUGRODMZCT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|