C17H13BrN2 — CID 135379707
11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine (PubChem CID 135379707) has the molecular formula C17H13BrN2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine.
| Compound Name | 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 135379707 |
| Molecular Formula | C17H13BrN2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine |
| SMILES | Cc1cc2c3ccc(Br)cc3c3nccn3c2cc1C |
| InChI | InChI=1S/C17H13BrN2/c1-10-7-14-13-4-3-12(18)9-15(13)17-19-5-6-20(17)16(14)8-11(10)2/h3-9H,1-2H3 |
| InChIKey | ZHICPZBQRDIMLX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|