About 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine
11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine (PubChem CID 135379707) has the molecular formula C17H13BrN2
and a molecular weight of 325.21 g/mol. Its IUPAC name is 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine.
Molecular Properties
| Compound Name | 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine |
| PubChem CID | 135379707 |
| Molecular Formula | C17H13BrN2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine |
| SMILES | Cc1cc2c3ccc(Br)cc3c3nccn3c2cc1C |
| InChI | InChI=1S/C17H13BrN2/c1-10-7-14-13-4-3-12(18)9-15(13)17-19-5-6-20(17)16(14)8-11(10)2/h3-9H,1-2H3 |
| InChIKey | ZHICPZBQRDIMLX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine?
The IUPAC name of 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine (CID 135379707) is 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine.
What is the SMILES notation for 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine?
The canonical SMILES for 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine is Cc1cc2c3ccc(Br)cc3c3nccn3c2cc1C.
What is the InChIKey of 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine?
The InChIKey is ZHICPZBQRDIMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN2/c1-10-7-14-13-4-3-12(18)9-15(13)17-19-5-6-20(17)16(14)8-11(10)2/h3-9H,1-2H3.
What are the key properties of 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine?
11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine has a molecular weight of 325.21 g/mol, XLogP of 5.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-bromo-6,7-dimethylimidazo[1,2-f]phenanthridine is sourced from PubChem (CID 135379707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).