C15H11N3 — CID 138528854
imidazo[1,2-f]phenanthridin-7-amine (PubChem CID 138528854) has the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. Its IUPAC name is imidazo[1,2-f]phenanthridin-7-amine.
| Compound Name | imidazo[1,2-f]phenanthridin-7-amine |
|---|---|
| PubChem CID | 138528854 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | imidazo[1,2-f]phenanthridin-7-amine |
| SMILES | Nc1ccc2c(c1)c1ccccc1c1nccn21 |
| InChI | InChI=1S/C15H11N3/c16-10-5-6-14-13(9-10)11-3-1-2-4-12(11)15-17-7-8-18(14)15/h1-9H,16H2 |
| InChIKey | AWSBSYINGJCXSN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|