C24H19BrN2 — CID 154611098
11-bromo-7-(2,4,6-trimethylphenyl)imidazo[1,2-f]phenanthridine (PubChem CID 154611098) has the molecular formula C24H19BrN2 and a molecular weight of 415.33 g/mol. Its IUPAC name is 11-bromo-7-(2,4,6-trimethylphenyl)imidazo[1,2-f]phenanthridine.
| Compound Name | 11-bromo-7-(2,4,6-trimethylphenyl)imidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 154611098 |
| Molecular Formula | C24H19BrN2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 11-bromo-7-(2,4,6-trimethylphenyl)imidazo[1,2-f]phenanthridine |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccc(Br)cc2c2nccn32)c(C)c1 |
| InChI | InChI=1S/C24H19BrN2/c1-14-10-15(2)23(16(3)11-14)17-4-7-22-20(12-17)19-6-5-18(25)13-21(19)24-26-8-9-27(22)24/h4-13H,1-3H3 |
| InChIKey | LQNLLBJJKDZARV-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|