C14H14BrN — CID 168984492
2-bromo-4-(2,4,6-trimethylphenyl)pyridine (PubChem CID 168984492) has the molecular formula C14H14BrN and a molecular weight of 276.18 g/mol. Its IUPAC name is 2-bromo-4-(2,4,6-trimethylphenyl)pyridine.
| Compound Name | 2-bromo-4-(2,4,6-trimethylphenyl)pyridine |
|---|---|
| PubChem CID | 168984492 |
| Molecular Formula | C14H14BrN |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-bromo-4-(2,4,6-trimethylphenyl)pyridine |
| SMILES | Cc1cc(C)c(-c2ccnc(Br)c2)c(C)c1 |
| InChI | InChI=1S/C14H14BrN/c1-9-6-10(2)14(11(3)7-9)12-4-5-16-13(15)8-12/h4-8H,1-3H3 |
| InChIKey | OGQNQEVPNFFNIC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|