C13H15BrN2 — CID 158791384
2-bromo-4-methylpyridine;2,4-dimethylpyridine (PubChem CID 158791384) has the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 2-bromo-4-methylpyridine;2,4-dimethylpyridine.
| Compound Name | 2-bromo-4-methylpyridine;2,4-dimethylpyridine |
|---|---|
| PubChem CID | 158791384 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-bromo-4-methylpyridine;2,4-dimethylpyridine |
| SMILES | Cc1ccnc(Br)c1.Cc1ccnc(C)c1 |
| InChI | InChI=1S/C7H9N.C6H6BrN/c1-6-3-4-8-7(2)5-6;1-5-2-3-8-6(7)4-5/h3-5H,1-2H3;2-4H,1H3 |
| InChIKey | ISHXFMZIJNHJAJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|