About 2,4-dibromopyridine;hydrochloride
2,4-dibromopyridine;hydrochloride (PubChem CID 87218885) has the molecular formula C5H4Br2ClN
and a molecular weight of 273.36 g/mol. Its IUPAC name is 2,4-dibromopyridine;hydrochloride.
Molecular Properties
| Compound Name | 2,4-dibromopyridine;hydrochloride |
| PubChem CID | 87218885 |
| Molecular Formula | C5H4Br2ClN |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 270.84 |
| IUPAC Name | 2,4-dibromopyridine;hydrochloride |
| SMILES | Brc1ccnc(Br)c1.Cl |
| InChI | InChI=1S/C5H3Br2N.ClH/c6-4-1-2-8-5(7)3-4;/h1-3H;1H |
| InChIKey | BIMBIIHFVYYAHB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromopyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromopyridine;hydrochloride?
The IUPAC name of 2,4-dibromopyridine;hydrochloride (CID 87218885) is 2,4-dibromopyridine;hydrochloride.
What is the SMILES notation for 2,4-dibromopyridine;hydrochloride?
The canonical SMILES for 2,4-dibromopyridine;hydrochloride is Brc1ccnc(Br)c1.Cl.
What is the InChIKey of 2,4-dibromopyridine;hydrochloride?
The InChIKey is BIMBIIHFVYYAHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Br2N.ClH/c6-4-1-2-8-5(7)3-4;/h1-3H;1H.
What are the key properties of 2,4-dibromopyridine;hydrochloride?
2,4-dibromopyridine;hydrochloride has a molecular weight of 273.36 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromopyridine;hydrochloride is sourced from PubChem (CID 87218885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).