C7H8BrClF2N2 — CID 171240805
(1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride (PubChem CID 171240805) has the molecular formula C7H8BrClF2N2 and a molecular weight of 273.51 g/mol. Its IUPAC name is (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride.
| Compound Name | (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride |
|---|---|
| PubChem CID | 171240805 |
| Molecular Formula | C7H8BrClF2N2 |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccnc(Br)c1)C(F)F |
| InChI | InChI=1S/C7H7BrF2N2.ClH/c8-5-3-4(1-2-12-5)6(11)7(9)10;/h1-3,6-7H,11H2;1H/t6-;/m1./s1 |
| InChIKey | LWHMRYPLDCUEFH-FYZOBXCZSA-N |
| XLogP | 2.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|