About (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride
(1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride (PubChem CID 171240805) has the molecular formula C7H8BrClF2N2
and a molecular weight of 273.51 g/mol. Its IUPAC name is (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride.
Molecular Properties
| Compound Name | (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride |
| PubChem CID | 171240805 |
| Molecular Formula | C7H8BrClF2N2 |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccnc(Br)c1)C(F)F |
| InChI | InChI=1S/C7H7BrF2N2.ClH/c8-5-3-4(1-2-12-5)6(11)7(9)10;/h1-3,6-7H,11H2;1H/t6-;/m1./s1 |
| InChIKey | LWHMRYPLDCUEFH-FYZOBXCZSA-N |
| XLogP | 2.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride?
The IUPAC name of (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride (CID 171240805) is (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride.
What is the SMILES notation for (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride?
The canonical SMILES for (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride is Cl.N[C@H](c1ccnc(Br)c1)C(F)F.
What is the InChIKey of (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride?
The InChIKey is LWHMRYPLDCUEFH-FYZOBXCZSA-N. The full InChI is InChI=1S/C7H7BrF2N2.ClH/c8-5-3-4(1-2-12-5)6(11)7(9)10;/h1-3,6-7H,11H2;1H/t6-;/m1./s1.
What are the key properties of (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride?
(1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride has a molecular weight of 273.51 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine;hydrochloride is sourced from PubChem (CID 171240805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).