C10H17BrClN3 — CID 171222997
(1S)-1-(2-bromo-4-pyridinyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171222997) has the molecular formula C10H17BrClN3 and a molecular weight of 294.62 g/mol. Its IUPAC name is (1S)-1-(2-bromo-4-pyridinyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-(2-bromo-4-pyridinyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171222997 |
| Molecular Formula | C10H17BrClN3 |
| Molecular Weight | 294.62 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (1S)-1-(2-bromo-4-pyridinyl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1ccnc(Br)c1 |
| InChI | InChI=1S/C10H16BrN3.ClH/c11-10-7-8(4-6-14-10)9(13)3-1-2-5-12;/h4,6-7,9H,1-3,5,12-13H2;1H/t9-;/m0./s1 |
| InChIKey | RIKNLVAGSUUKJZ-FVGYRXGTSA-N |
| XLogP | 2.39 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|