C10H17Cl2N2OPt+ — CID 50909668
dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium (PubChem CID 50909668) has the molecular formula C10H17Cl2N2OPt+ and a molecular weight of 447.24 g/mol. Its IUPAC name is dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium.
| Compound Name | dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium |
|---|---|
| PubChem CID | 50909668 |
| Molecular Formula | C10H17Cl2N2OPt+ |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium |
| SMILES | C[N+](C)=CO.Cc1ccnc(C)c1.Cl[Pt]Cl |
| InChI | InChI=1S/C7H9N.C3H7NO.2ClH.Pt/c1-6-3-4-8-7(2)5-6;1-4(2)3-5;;;/h3-5H,1-2H3;3H,1-2H3;2*1H;/q;;;;+2/p-1 |
| InChIKey | NDULGTFHAUYIAR-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 36.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|