About dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium
dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium (PubChem CID 50909668) has the molecular formula C10H17Cl2N2OPt+
and a molecular weight of 447.24 g/mol. Its IUPAC name is dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium.
Molecular Properties
| Compound Name | dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium |
| PubChem CID | 50909668 |
| Molecular Formula | C10H17Cl2N2OPt+ |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium |
| SMILES | C[N+](C)=CO.Cc1ccnc(C)c1.Cl[Pt]Cl |
| InChI | InChI=1S/C7H9N.C3H7NO.2ClH.Pt/c1-6-3-4-8-7(2)5-6;1-4(2)3-5;;;/h3-5H,1-2H3;3H,1-2H3;2*1H;/q;;;;+2/p-1 |
| InChIKey | NDULGTFHAUYIAR-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 36.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium?
The IUPAC name of dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium (CID 50909668) is dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium.
What is the SMILES notation for dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium?
The canonical SMILES for dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium is C[N+](C)=CO.Cc1ccnc(C)c1.Cl[Pt]Cl.
What is the InChIKey of dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium?
The InChIKey is NDULGTFHAUYIAR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9N.C3H7NO.2ClH.Pt/c1-6-3-4-8-7(2)5-6;1-4(2)3-5;;;/h3-5H,1-2H3;3H,1-2H3;2*1H;/q;;;;+2/p-1.
What are the key properties of dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium?
dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium has a molecular weight of 447.24 g/mol, XLogP of 2.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;2,4-dimethylpyridine;hydroxymethylidene(dimethyl)azanium is sourced from PubChem (CID 50909668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).