C15H20N2 — CID 144600584
2,4-dimethylpyridine;3-ethyl-5-methylpyridine (PubChem CID 144600584) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2,4-dimethylpyridine;3-ethyl-5-methylpyridine.
| Compound Name | 2,4-dimethylpyridine;3-ethyl-5-methylpyridine |
|---|---|
| PubChem CID | 144600584 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2,4-dimethylpyridine;3-ethyl-5-methylpyridine |
| SMILES | CCc1cncc(C)c1.Cc1ccnc(C)c1 |
| InChI | InChI=1S/C8H11N.C7H9N/c1-3-8-4-7(2)5-9-6-8;1-6-3-4-8-7(2)5-6/h4-6H,3H2,1-2H3;3-5H,1-2H3 |
| InChIKey | WDTFIXBPOQZLMK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |