About 4-ethyl-2-methylpyridine;molecular fluorine
4-ethyl-2-methylpyridine;molecular fluorine (PubChem CID 143740700) has the molecular formula C8H11F2N
and a molecular weight of 159.18 g/mol. Its IUPAC name is 4-ethyl-2-methylpyridine;molecular fluorine.
Molecular Properties
| Compound Name | 4-ethyl-2-methylpyridine;molecular fluorine |
| PubChem CID | 143740700 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 4-ethyl-2-methylpyridine;molecular fluorine |
| SMILES | CCc1ccnc(C)c1.FF |
| InChI | InChI=1S/C8H11N.F2/c1-3-8-4-5-9-7(2)6-8;1-2/h4-6H,3H2,1-2H3; |
| InChIKey | JSGFRVIKQOMPFT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-2-methylpyridine;molecular fluorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylpyridine;molecular fluorine?
The IUPAC name of 4-ethyl-2-methylpyridine;molecular fluorine (CID 143740700) is 4-ethyl-2-methylpyridine;molecular fluorine.
What is the SMILES notation for 4-ethyl-2-methylpyridine;molecular fluorine?
The canonical SMILES for 4-ethyl-2-methylpyridine;molecular fluorine is CCc1ccnc(C)c1.FF.
What is the InChIKey of 4-ethyl-2-methylpyridine;molecular fluorine?
The InChIKey is JSGFRVIKQOMPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.F2/c1-3-8-4-5-9-7(2)6-8;1-2/h4-6H,3H2,1-2H3;.
What are the key properties of 4-ethyl-2-methylpyridine;molecular fluorine?
4-ethyl-2-methylpyridine;molecular fluorine has a molecular weight of 159.18 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylpyridine;molecular fluorine is sourced from PubChem (CID 143740700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).