About 4-butyl-2-methylpyridine;hydrobromide
4-butyl-2-methylpyridine;hydrobromide (PubChem CID 173184435) has the molecular formula C10H16BrN
and a molecular weight of 230.15 g/mol. Its IUPAC name is 4-butyl-2-methylpyridine;hydrobromide.
Molecular Properties
| Compound Name | 4-butyl-2-methylpyridine;hydrobromide |
| PubChem CID | 173184435 |
| Molecular Formula | C10H16BrN |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-butyl-2-methylpyridine;hydrobromide |
| SMILES | Br.CCCCc1ccnc(C)c1 |
| InChI | InChI=1S/C10H15N.BrH/c1-3-4-5-10-6-7-11-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H |
| InChIKey | GBWKYOHHECUQKJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butyl-2-methylpyridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2-methylpyridine;hydrobromide?
The IUPAC name of 4-butyl-2-methylpyridine;hydrobromide (CID 173184435) is 4-butyl-2-methylpyridine;hydrobromide.
What is the SMILES notation for 4-butyl-2-methylpyridine;hydrobromide?
The canonical SMILES for 4-butyl-2-methylpyridine;hydrobromide is Br.CCCCc1ccnc(C)c1.
What is the InChIKey of 4-butyl-2-methylpyridine;hydrobromide?
The InChIKey is GBWKYOHHECUQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.BrH/c1-3-4-5-10-6-7-11-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H.
What are the key properties of 4-butyl-2-methylpyridine;hydrobromide?
4-butyl-2-methylpyridine;hydrobromide has a molecular weight of 230.15 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-methylpyridine;hydrobromide is sourced from PubChem (CID 173184435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).