About 4-ethyl-2-methylpyridine;propan-2-ol
4-ethyl-2-methylpyridine;propan-2-ol (PubChem CID 145226128) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-ethyl-2-methylpyridine;propan-2-ol.
Molecular Properties
| Compound Name | 4-ethyl-2-methylpyridine;propan-2-ol |
| PubChem CID | 145226128 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-ethyl-2-methylpyridine;propan-2-ol |
| SMILES | CC(C)O.CCc1ccnc(C)c1 |
| InChI | InChI=1S/C8H11N.C3H8O/c1-3-8-4-5-9-7(2)6-8;1-3(2)4/h4-6H,3H2,1-2H3;3-4H,1-2H3 |
| InChIKey | JHZQOLWATXFVJK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-2-methylpyridine;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylpyridine;propan-2-ol?
The IUPAC name of 4-ethyl-2-methylpyridine;propan-2-ol (CID 145226128) is 4-ethyl-2-methylpyridine;propan-2-ol.
What is the SMILES notation for 4-ethyl-2-methylpyridine;propan-2-ol?
The canonical SMILES for 4-ethyl-2-methylpyridine;propan-2-ol is CC(C)O.CCc1ccnc(C)c1.
What is the InChIKey of 4-ethyl-2-methylpyridine;propan-2-ol?
The InChIKey is JHZQOLWATXFVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C3H8O/c1-3-8-4-5-9-7(2)6-8;1-3(2)4/h4-6H,3H2,1-2H3;3-4H,1-2H3.
What are the key properties of 4-ethyl-2-methylpyridine;propan-2-ol?
4-ethyl-2-methylpyridine;propan-2-ol has a molecular weight of 181.28 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylpyridine;propan-2-ol is sourced from PubChem (CID 145226128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).