C15H22N2 — CID 143179513
2,4-dimethylpyridine;ethane;2-methylpyridine (PubChem CID 143179513) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2,4-dimethylpyridine;ethane;2-methylpyridine.
| Compound Name | 2,4-dimethylpyridine;ethane;2-methylpyridine |
|---|---|
| PubChem CID | 143179513 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2,4-dimethylpyridine;ethane;2-methylpyridine |
| SMILES | CC.Cc1ccccn1.Cc1ccnc(C)c1 |
| InChI | InChI=1S/C7H9N.C6H7N.C2H6/c1-6-3-4-8-7(2)5-6;1-6-4-2-3-5-7-6;1-2/h3-5H,1-2H3;2-5H,1H3;1-2H3 |
| InChIKey | NOPVVIKAWAYXBV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |