About 2,4-dimethylpyridine;ethane;2-methylpyridine
2,4-dimethylpyridine;ethane;2-methylpyridine (PubChem CID 143179513) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2,4-dimethylpyridine;ethane;2-methylpyridine.
Molecular Properties
| Compound Name | 2,4-dimethylpyridine;ethane;2-methylpyridine |
| PubChem CID | 143179513 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2,4-dimethylpyridine;ethane;2-methylpyridine |
| SMILES | CC.Cc1ccccn1.Cc1ccnc(C)c1 |
| InChI | InChI=1S/C7H9N.C6H7N.C2H6/c1-6-3-4-8-7(2)5-6;1-6-4-2-3-5-7-6;1-2/h3-5H,1-2H3;2-5H,1H3;1-2H3 |
| InChIKey | NOPVVIKAWAYXBV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylpyridine;ethane;2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpyridine;ethane;2-methylpyridine?
The IUPAC name of 2,4-dimethylpyridine;ethane;2-methylpyridine (CID 143179513) is 2,4-dimethylpyridine;ethane;2-methylpyridine.
What is the SMILES notation for 2,4-dimethylpyridine;ethane;2-methylpyridine?
The canonical SMILES for 2,4-dimethylpyridine;ethane;2-methylpyridine is CC.Cc1ccccn1.Cc1ccnc(C)c1.
What is the InChIKey of 2,4-dimethylpyridine;ethane;2-methylpyridine?
The InChIKey is NOPVVIKAWAYXBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C6H7N.C2H6/c1-6-3-4-8-7(2)5-6;1-6-4-2-3-5-7-6;1-2/h3-5H,1-2H3;2-5H,1H3;1-2H3.
What are the key properties of 2,4-dimethylpyridine;ethane;2-methylpyridine?
2,4-dimethylpyridine;ethane;2-methylpyridine has a molecular weight of 230.35 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpyridine;ethane;2-methylpyridine is sourced from PubChem (CID 143179513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).