C17H30N2 — CID 143140657
ethane;2-methylpyridine;1,2,4-trimethylpyrrole (PubChem CID 143140657) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is ethane;2-methylpyridine;1,2,4-trimethylpyrrole.
| Compound Name | ethane;2-methylpyridine;1,2,4-trimethylpyrrole |
|---|---|
| PubChem CID | 143140657 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | ethane;2-methylpyridine;1,2,4-trimethylpyrrole |
| SMILES | CC.CC.Cc1cc(C)n(C)c1.Cc1ccccn1 |
| InChI | InChI=1S/C7H11N.C6H7N.2C2H6/c1-6-4-7(2)8(3)5-6;1-6-4-2-3-5-7-6;2*1-2/h4-5H,1-3H3;2-5H,1H3;2*1-2H3 |
| InChIKey | PFVWDTWASLRPFW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |